C19H19N3O2S — CID 24754248
5'-(4-methoxyphenyl)-6-propylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (PubChem CID 24754248) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 5'-(4-methoxyphenyl)-6-propylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one.
| Compound Name | 5'-(4-methoxyphenyl)-6-propylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
|---|---|
| PubChem CID | 24754248 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 5'-(4-methoxyphenyl)-6-propylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| SMILES | CCCc1ccc2c(c1)NC(=O)C21NN=C(c2ccc(OC)cc2)S1 |
| InChI | InChI=1S/C19H19N3O2S/c1-3-4-12-5-10-15-16(11-12)20-18(23)19(15)22-21-17(25-19)13-6-8-14(24-2)9-7-13/h5-11,22H,3-4H2,1-2H3,(H,20,23) |
| InChIKey | HBXVEQHRTCDTPV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|