C24H21N3O2S — CID 24754252
5-(4-methoxyphenyl)-5'-methyl-1'-(2-methylphenyl)spiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (PubChem CID 24754252) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5'-methyl-1'-(2-methylphenyl)spiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one.
| Compound Name | 5-(4-methoxyphenyl)-5'-methyl-1'-(2-methylphenyl)spiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 24754252 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-5'-methyl-1'-(2-methylphenyl)spiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| SMILES | COc1ccc(C2=NNC3(S2)C(=O)N(c2ccccc2C)c2ccc(C)cc23)cc1 |
| InChI | InChI=1S/C24H21N3O2S/c1-15-8-13-21-19(14-15)24(23(28)27(21)20-7-5-4-6-16(20)2)26-25-22(30-24)17-9-11-18(29-3)12-10-17/h4-14,26H,1-3H3 |
| InChIKey | DPMMJDFRISXTPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|