C17H28O2 — CID 24754362
(3'aR,6'aS)-2',2'-dimethyl-6'a-[(2S)-pent-4-en-2-yl]spiro[1,3-dioxolane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene] (PubChem CID 24754362) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (3'aR,6'aS)-2',2'-dimethyl-6'a-[(2S)-pent-4-en-2-yl]spiro[1,3-dioxolane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene].
| Compound Name | (3'aR,6'aS)-2',2'-dimethyl-6'a-[(2S)-pent-4-en-2-yl]spiro[1,3-dioxolane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene] |
|---|---|
| PubChem CID | 24754362 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (3'aR,6'aS)-2',2'-dimethyl-6'a-[(2S)-pent-4-en-2-yl]spiro[1,3-dioxolane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene] |
| SMILES | C=CC[C@H](C)[C@@]12CC(C)(C)C[C@@H]1CC1(C2)OCCO1 |
| InChI | InChI=1S/C17H28O2/c1-5-6-13(2)16-11-15(3,4)9-14(16)10-17(12-16)18-7-8-19-17/h5,13-14H,1,6-12H2,2-4H3/t13-,14+,16-/m0/s1 |
| InChIKey | RQAIBVIEERLGBH-LZWOXQAQSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|