About 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol
4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol (PubChem CID 24754471) has the molecular formula C18H20O7S
and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol |
| PubChem CID | 24754471 |
| Molecular Formula | C18H20O7S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol |
| SMILES | COc1ccc(CS(=O)(=O)/C=C/c2c(OC)cc(O)cc2OC)cc1O |
| InChI | InChI=1S/C18H20O7S/c1-23-16-5-4-12(8-15(16)20)11-26(21,22)7-6-14-17(24-2)9-13(19)10-18(14)25-3/h4-10,19-20H,11H2,1-3H3/b7-6+ |
| InChIKey | OTWGKUIKFHQDCG-VOTSOKGWSA-N |
| XLogP | 2.71 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol?
The IUPAC name of 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol (CID 24754471) is 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol.
What is the SMILES notation for 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol?
The canonical SMILES for 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol is COc1ccc(CS(=O)(=O)/C=C/c2c(OC)cc(O)cc2OC)cc1O.
What is the InChIKey of 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol?
The InChIKey is OTWGKUIKFHQDCG-VOTSOKGWSA-N. The full InChI is InChI=1S/C18H20O7S/c1-23-16-5-4-12(8-15(16)20)11-26(21,22)7-6-14-17(24-2)9-13(19)10-18(14)25-3/h4-10,19-20H,11H2,1-3H3/b7-6+.
What are the key properties of 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol?
4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol has a molecular weight of 380.42 g/mol, XLogP of 2.71, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[(3-hydroxy-4-methoxyphenyl)methylsulfonyl]ethenyl]-3,5-dimethoxyphenol is sourced from PubChem (CID 24754471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).