C31H28O8S2 — CID 24754960
[4-[2-[(2S,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-oxooxan-2-yl]ethyl]phenyl] benzenesulfonate (PubChem CID 24754960) has the molecular formula C31H28O8S2 and a molecular weight of 592.69 g/mol. Its IUPAC name is [4-[2-[(2S,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-oxooxan-2-yl]ethyl]phenyl] benzenesulfonate.
| Compound Name | [4-[2-[(2S,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-oxooxan-2-yl]ethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 24754960 |
| Molecular Formula | C31H28O8S2 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | [4-[2-[(2S,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-oxooxan-2-yl]ethyl]phenyl] benzenesulfonate |
| SMILES | O=C1C[C@H](CCc2ccc(OS(=O)(=O)c3ccccc3)cc2)O[C@H](c2ccc(OS(=O)(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C31H28O8S2/c32-25-21-28(18-13-23-11-16-26(17-12-23)38-40(33,34)29-7-3-1-4-8-29)37-31(22-25)24-14-19-27(20-15-24)39-41(35,36)30-9-5-2-6-10-30/h1-12,14-17,19-20,28,31H,13,18,21-22H2/t28-,31-/m0/s1 |
| InChIKey | SSZKJUOMZSMGIB-IZEXYCQBSA-N |
| XLogP | 5.64 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|