About tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate
tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate (PubChem CID 24755008) has the molecular formula C15H19F3N2O4
and a molecular weight of 348.32 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate |
| PubChem CID | 24755008 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate |
| SMILES | C[C@H]([C@@H](NC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H19F3N2O4/c1-9(20(22)23)12(19-13(21)24-14(2,3)4)10-5-7-11(8-6-10)15(16,17)18/h5-9,12H,1-4H3,(H,19,21)/t9-,12-/m1/s1 |
| InChIKey | ZOEKUOZRCXAATM-BXKDBHETSA-N |
| XLogP | 3.94 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate?
The IUPAC name of tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate (CID 24755008) is tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate is C[C@H]([C@@H](NC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cc1)[N+](=O)[O-].
What is the InChIKey of tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate?
The InChIKey is ZOEKUOZRCXAATM-BXKDBHETSA-N. The full InChI is InChI=1S/C15H19F3N2O4/c1-9(20(22)23)12(19-13(21)24-14(2,3)4)10-5-7-11(8-6-10)15(16,17)18/h5-9,12H,1-4H3,(H,19,21)/t9-,12-/m1/s1.
What are the key properties of tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate?
tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate has a molecular weight of 348.32 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S,2R)-2-nitro-1-[4-(trifluoromethyl)phenyl]propyl]carbamate is sourced from PubChem (CID 24755008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).