C32H27F3O10S3 — CID 24755033
[4-[2-[(2S,6S)-2-[4-(benzenesulfonyloxy)phenyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-6-yl]ethyl]phenyl] benzenesulfonate (PubChem CID 24755033) has the molecular formula C32H27F3O10S3 and a molecular weight of 724.75 g/mol. Its IUPAC name is [4-[2-[(2S,6S)-2-[4-(benzenesulfonyloxy)phenyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-6-yl]ethyl]phenyl] benzenesulfonate.
| Compound Name | [4-[2-[(2S,6S)-2-[4-(benzenesulfonyloxy)phenyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-6-yl]ethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 24755033 |
| Molecular Formula | C32H27F3O10S3 |
| Molecular Weight | 724.75 g/mol |
| Exact Mass | 724.07 |
| IUPAC Name | [4-[2-[(2S,6S)-2-[4-(benzenesulfonyloxy)phenyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyran-6-yl]ethyl]phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(CC[C@H]2C=C(OS(=O)(=O)C(F)(F)F)C[C@@H](c3ccc(OS(=O)(=O)c4ccccc4)cc3)O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H27F3O10S3/c33-32(34,35)48(40,41)45-28-21-27(18-13-23-11-16-25(17-12-23)43-46(36,37)29-7-3-1-4-8-29)42-31(22-28)24-14-19-26(20-15-24)44-47(38,39)30-9-5-2-6-10-30/h1-12,14-17,19-21,27,31H,13,18,22H2/t27-,31-/m0/s1 |
| InChIKey | NYVPIYOAUKGLRD-DHIFEGFHSA-N |
| XLogP | 6.43 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.75 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|