C18H18ClNO3S — CID 24755047
2-[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]-2-methyl-3-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 24755047) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]-2-methyl-3-(4-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]-2-methyl-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24755047 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]-2-methyl-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)CSC2(C)c2cc(Cl)cc(CO)c2O)cc1 |
| InChI | InChI=1S/C18H18ClNO3S/c1-11-3-5-14(6-4-11)20-16(22)10-24-18(20,2)15-8-13(19)7-12(9-21)17(15)23/h3-8,21,23H,9-10H2,1-2H3 |
| InChIKey | NUHTZRZXWZENHT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|