C27H36O8 — CID 24755055
(2E,4E)-5-[(1R,7S,8S,9R)-7-acetyloxy-9-methyl-4-(3-methylbutoxycarbonyl)-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid (PubChem CID 24755055) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is (2E,4E)-5-[(1R,7S,8S,9R)-7-acetyloxy-9-methyl-4-(3-methylbutoxycarbonyl)-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1R,7S,8S,9R)-7-acetyloxy-9-methyl-4-(3-methylbutoxycarbonyl)-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 24755055 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (2E,4E)-5-[(1R,7S,8S,9R)-7-acetyloxy-9-methyl-4-(3-methylbutoxycarbonyl)-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid |
| SMILES | CC(=O)O[C@]12CCC(C(=O)OCCC(C)C)=CC[C@]13CC[C@H]2[C@@](C)(/C=C/C=C(\C)C(=O)O)OC3=O |
| InChI | InChI=1S/C27H36O8/c1-17(2)11-16-33-23(31)20-8-13-26-14-10-21(27(26,15-9-20)34-19(4)28)25(5,35-24(26)32)12-6-7-18(3)22(29)30/h6-8,12,17,21H,9-11,13-16H2,1-5H3,(H,29,30)/b12-6+,18-7+/t21-,25+,26+,27-/m0/s1 |
| InChIKey | LGESFEADIBCBSG-OMVNRVKDSA-N |
| XLogP | 4.29 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|