C11H11F9O4S — CID 24755177
[(Z)-6-oxohept-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 24755177) has the molecular formula C11H11F9O4S and a molecular weight of 410.25 g/mol. Its IUPAC name is [(Z)-6-oxohept-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(Z)-6-oxohept-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 24755177 |
| Molecular Formula | C11H11F9O4S |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | [(Z)-6-oxohept-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(=O)CCC/C=C\OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F9O4S/c1-7(21)5-3-2-4-6-24-25(22,23)11(19,20)9(14,15)8(12,13)10(16,17)18/h4,6H,2-3,5H2,1H3/b6-4- |
| InChIKey | XGRYJLSOADTECJ-XQRVVYSFSA-N |
| XLogP | 4.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|