C19H21N5O4 — CID 24755189
methyl 4-[5-(ethoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (PubChem CID 24755189) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl 4-[5-(ethoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate.
| Compound Name | methyl 4-[5-(ethoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 24755189 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | methyl 4-[5-(ethoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| SMILES | CCONC(=O)c1ccc(C)c(Nc2ncnn3cc(C(=O)OC)c(C)c23)c1 |
| InChI | InChI=1S/C19H21N5O4/c1-5-28-23-18(25)13-7-6-11(2)15(8-13)22-17-16-12(3)14(19(26)27-4)9-24(16)21-10-20-17/h6-10H,5H2,1-4H3,(H,23,25)(H,20,21,22) |
| InChIKey | JGGHHUHKLRMREP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|