C36H52Br2N4 — CID 24755212
3-[(2S)-1-methylpyrrolidin-2-yl]-1-[5-[2-[5-[3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pentyl]phenyl]pentyl]pyridin-1-ium dibromide (PubChem CID 24755212) has the molecular formula C36H52Br2N4 and a molecular weight of 700.65 g/mol. Its IUPAC name is 3-[(2S)-1-methylpyrrolidin-2-yl]-1-[5-[2-[5-[3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pentyl]phenyl]pentyl]pyridin-1-ium dibromide.
| Compound Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1-[5-[2-[5-[3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pentyl]phenyl]pentyl]pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 24755212 |
| Molecular Formula | C36H52Br2N4 |
| Molecular Weight | 700.65 g/mol |
| Exact Mass | 698.26 |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1-[5-[2-[5-[3-[(2S)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pentyl]phenyl]pentyl]pyridin-1-ium dibromide |
| SMILES | CN1CCC[C@H]1c1ccc[n+](CCCCCc2ccccc2CCCCC[n+]2cccc([C@@H]3CCCN3C)c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C36H52N4.2BrH/c1-37-23-13-21-35(37)33-19-11-27-39(29-33)25-9-3-5-15-31-17-7-8-18-32(31)16-6-4-10-26-40-28-12-20-34(30-40)36-22-14-24-38(36)2;;/h7-8,11-12,17-20,27-30,35-36H,3-6,9-10,13-16,21-26H2,1-2H3;2*1H/q+2;;/p-2/t35-,36-;;/m0../s1 |
| InChIKey | PMFUIQOATHBBPQ-ZHHFVJILSA-L |
| XLogP | 0.63 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.65 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|