About N-benzylidene-4,4-difluorocyclohexane-1-carboxamide
N-benzylidene-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 24755222) has the molecular formula C14H15F2NO
and a molecular weight of 251.28 g/mol. Its IUPAC name is N-benzylidene-4,4-difluorocyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-benzylidene-4,4-difluorocyclohexane-1-carboxamide |
| PubChem CID | 24755222 |
| Molecular Formula | C14H15F2NO |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-benzylidene-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | O=C(/N=C/c1ccccc1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H15F2NO/c15-14(16)8-6-12(7-9-14)13(18)17-10-11-4-2-1-3-5-11/h1-5,10,12H,6-9H2/b17-10+ |
| InChIKey | ZRPUDFFZZMMBQG-LICLKQGHSA-N |
| XLogP | 3.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzylidene-4,4-difluorocyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylidene-4,4-difluorocyclohexane-1-carboxamide?
The IUPAC name of N-benzylidene-4,4-difluorocyclohexane-1-carboxamide (CID 24755222) is N-benzylidene-4,4-difluorocyclohexane-1-carboxamide.
What is the SMILES notation for N-benzylidene-4,4-difluorocyclohexane-1-carboxamide?
The canonical SMILES for N-benzylidene-4,4-difluorocyclohexane-1-carboxamide is O=C(/N=C/c1ccccc1)C1CCC(F)(F)CC1.
What is the InChIKey of N-benzylidene-4,4-difluorocyclohexane-1-carboxamide?
The InChIKey is ZRPUDFFZZMMBQG-LICLKQGHSA-N. The full InChI is InChI=1S/C14H15F2NO/c15-14(16)8-6-12(7-9-14)13(18)17-10-11-4-2-1-3-5-11/h1-5,10,12H,6-9H2/b17-10+.
What are the key properties of N-benzylidene-4,4-difluorocyclohexane-1-carboxamide?
N-benzylidene-4,4-difluorocyclohexane-1-carboxamide has a molecular weight of 251.28 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylidene-4,4-difluorocyclohexane-1-carboxamide is sourced from PubChem (CID 24755222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).