C17H17N5O4 — CID 24755247
methyl 4-[5-(methoxycarbamoyl)-2-methylanilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (PubChem CID 24755247) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is methyl 4-[5-(methoxycarbamoyl)-2-methylanilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate.
| Compound Name | methyl 4-[5-(methoxycarbamoyl)-2-methylanilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 24755247 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 4-[5-(methoxycarbamoyl)-2-methylanilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| SMILES | CONC(=O)c1ccc(C)c(Nc2ncnn3cc(C(=O)OC)cc23)c1 |
| InChI | InChI=1S/C17H17N5O4/c1-10-4-5-11(16(23)21-26-3)6-13(10)20-15-14-7-12(17(24)25-2)8-22(14)19-9-18-15/h4-9H,1-3H3,(H,21,23)(H,18,19,20) |
| InChIKey | UKOVPDRYJKSKRD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|