C29H31ClO8 — CID 24755262
(2E,4E)-5-[(1R,7S,8S,9R)-7-[2-(4-chlorophenyl)acetyl]oxy-4-methoxycarbonyl-9-methyl-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid (PubChem CID 24755262) has the molecular formula C29H31ClO8 and a molecular weight of 543.01 g/mol. Its IUPAC name is (2E,4E)-5-[(1R,7S,8S,9R)-7-[2-(4-chlorophenyl)acetyl]oxy-4-methoxycarbonyl-9-methyl-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1R,7S,8S,9R)-7-[2-(4-chlorophenyl)acetyl]oxy-4-methoxycarbonyl-9-methyl-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 24755262 |
| Molecular Formula | C29H31ClO8 |
| Molecular Weight | 543.01 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (2E,4E)-5-[(1R,7S,8S,9R)-7-[2-(4-chlorophenyl)acetyl]oxy-4-methoxycarbonyl-9-methyl-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-en-9-yl]-2-methylpenta-2,4-dienoic acid |
| SMILES | COC(=O)C1=CC[C@@]23CC[C@@H]([C@@](C)(/C=C/C=C(\C)C(=O)O)OC2=O)[C@@]3(OC(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C29H31ClO8/c1-18(24(32)33)5-4-13-27(2)22-12-15-28(26(35)38-27)14-10-20(25(34)36-3)11-16-29(22,28)37-23(31)17-19-6-8-21(30)9-7-19/h4-10,13,22H,11-12,14-17H2,1-3H3,(H,32,33)/b13-4+,18-5+/t22-,27+,28+,29-/m0/s1 |
| InChIKey | NASCNLSRANKCAV-JOCDDQNKSA-N |
| XLogP | 4.75 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.01 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|