C20H24N6O3 — CID 24755333
N-methoxy-4-methyl-3-[[5-methyl-6-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide (PubChem CID 24755333) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-methoxy-4-methyl-3-[[5-methyl-6-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide.
| Compound Name | N-methoxy-4-methyl-3-[[5-methyl-6-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 24755333 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-methoxy-4-methyl-3-[[5-methyl-6-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]benzamide |
| SMILES | CONC(=O)c1ccc(C)c(Nc2ncnn3cc(NC(=O)C(C)C)c(C)c23)c1 |
| InChI | InChI=1S/C20H24N6O3/c1-11(2)19(27)24-16-9-26-17(13(16)4)18(21-10-22-26)23-15-8-14(7-6-12(15)3)20(28)25-29-5/h6-11H,1-5H3,(H,24,27)(H,25,28)(H,21,22,23) |
| InChIKey | ZNWHEYZTCXCRIA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|