About (E,3S)-5-iodo-3,4-dimethylpent-4-enal
(E,3S)-5-iodo-3,4-dimethylpent-4-enal (PubChem CID 24756006) has the molecular formula C7H11IO
and a molecular weight of 238.07 g/mol. Its IUPAC name is (E,3S)-5-iodo-3,4-dimethylpent-4-enal.
Molecular Properties
| Compound Name | (E,3S)-5-iodo-3,4-dimethylpent-4-enal |
| PubChem CID | 24756006 |
| Molecular Formula | C7H11IO |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | (E,3S)-5-iodo-3,4-dimethylpent-4-enal |
| SMILES | C/C(=C\I)[C@@H](C)CC=O |
| InChI | InChI=1S/C7H11IO/c1-6(3-4-9)7(2)5-8/h4-6H,3H2,1-2H3/b7-5+/t6-/m0/s1 |
| InChIKey | VTFKNNRXJDACJM-YXXZKMSWSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E,3S)-5-iodo-3,4-dimethylpent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3S)-5-iodo-3,4-dimethylpent-4-enal?
The IUPAC name of (E,3S)-5-iodo-3,4-dimethylpent-4-enal (CID 24756006) is (E,3S)-5-iodo-3,4-dimethylpent-4-enal.
What is the SMILES notation for (E,3S)-5-iodo-3,4-dimethylpent-4-enal?
The canonical SMILES for (E,3S)-5-iodo-3,4-dimethylpent-4-enal is C/C(=C\I)[C@@H](C)CC=O.
What is the InChIKey of (E,3S)-5-iodo-3,4-dimethylpent-4-enal?
The InChIKey is VTFKNNRXJDACJM-YXXZKMSWSA-N. The full InChI is InChI=1S/C7H11IO/c1-6(3-4-9)7(2)5-8/h4-6H,3H2,1-2H3/b7-5+/t6-/m0/s1.
What are the key properties of (E,3S)-5-iodo-3,4-dimethylpent-4-enal?
(E,3S)-5-iodo-3,4-dimethylpent-4-enal has a molecular weight of 238.07 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3S)-5-iodo-3,4-dimethylpent-4-enal is sourced from PubChem (CID 24756006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).