C20H44O2Si2 — CID 24756074
tert-butyl-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylhept-6-en-2-yl]oxy-dimethylsilane (PubChem CID 24756074) has the molecular formula C20H44O2Si2 and a molecular weight of 372.74 g/mol. Its IUPAC name is tert-butyl-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylhept-6-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylhept-6-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 24756074 |
| Molecular Formula | C20H44O2Si2 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | tert-butyl-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methylhept-6-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](C)[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O2Si2/c1-14-16(2)18(22-24(12,13)20(7,8)9)15-17(3)21-23(10,11)19(4,5)6/h14,16-18H,1,15H2,2-13H3/t16-,17-,18-/m1/s1 |
| InChIKey | XIRFAQJMXQPFCX-KZNAEPCWSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|