C14H18Br2Si — CID 24756184
2-(3,4-dibromophenyl)ethynyl-triethylsilane (PubChem CID 24756184) has the molecular formula C14H18Br2Si and a molecular weight of 374.19 g/mol. Its IUPAC name is 2-(3,4-dibromophenyl)ethynyl-triethylsilane.
| Compound Name | 2-(3,4-dibromophenyl)ethynyl-triethylsilane |
|---|---|
| PubChem CID | 24756184 |
| Molecular Formula | C14H18Br2Si |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 2-(3,4-dibromophenyl)ethynyl-triethylsilane |
| SMILES | CC[Si](C#Cc1ccc(Br)c(Br)c1)(CC)CC |
| InChI | InChI=1S/C14H18Br2Si/c1-4-17(5-2,6-3)10-9-12-7-8-13(15)14(16)11-12/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | RPBRKIBXBYYBLC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|