C26H18N4O2S2 — CID 24756228
(5Z)-3-(1H-benzimidazol-2-ylmethyl)-5-[[5-(4-pyrrol-1-ylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 24756228) has the molecular formula C26H18N4O2S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is (5Z)-3-(1H-benzimidazol-2-ylmethyl)-5-[[5-(4-pyrrol-1-ylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1H-benzimidazol-2-ylmethyl)-5-[[5-(4-pyrrol-1-ylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24756228 |
| Molecular Formula | C26H18N4O2S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (5Z)-3-(1H-benzimidazol-2-ylmethyl)-5-[[5-(4-pyrrol-1-ylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccc(-n4cccc4)cc3)o2)SC(=S)N1Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H18N4O2S2/c31-25-23(34-26(33)30(25)16-24-27-20-5-1-2-6-21(20)28-24)15-19-11-12-22(32-19)17-7-9-18(10-8-17)29-13-3-4-14-29/h1-15H,16H2,(H,27,28)/b23-15- |
| InChIKey | NWMFAMAVUYQZGI-HAHDFKILSA-N |
| XLogP | 6.01 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|