C16H32O4Si — CID 24756275
ethyl (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate (PubChem CID 24756275) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is ethyl (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate.
| Compound Name | ethyl (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate |
|---|---|
| PubChem CID | 24756275 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | ethyl (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C[C@@H](C)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-8-19-15(18)11-9-10-14(12-13(2)17)20-21(6,7)16(3,4)5/h9,11,13-14,17H,8,10,12H2,1-7H3/b11-9+/t13-,14+/m1/s1 |
| InChIKey | HKGCLBZBMPHYAT-CACDNMLQSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|