C33H60O2Si2 — CID 24756281
tert-butyl-[2-[(1S,4R,5R,6R,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-oct-6-enyl]-7-bicyclo[2.2.1]hept-2-enyl]prop-2-enoxy]-dimethylsilane (PubChem CID 24756281) has the molecular formula C33H60O2Si2 and a molecular weight of 545.01 g/mol. Its IUPAC name is tert-butyl-[2-[(1S,4R,5R,6R,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-oct-6-enyl]-7-bicyclo[2.2.1]hept-2-enyl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(1S,4R,5R,6R,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-oct-6-enyl]-7-bicyclo[2.2.1]hept-2-enyl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 24756281 |
| Molecular Formula | C33H60O2Si2 |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | tert-butyl-[2-[(1S,4R,5R,6R,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-oct-6-enyl]-7-bicyclo[2.2.1]hept-2-enyl]prop-2-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1[C@@H](CCCCC/C=C/C)[C@@H]2C=C[C@H]1[C@@]2(CO[Si](C)(C)C(C)(C)C)C(=C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H60O2Si2/c1-14-16-17-18-19-20-21-28-27(15-2)29-22-23-30(28)33(29,25-35-37(12,13)32(7,8)9)26(3)24-34-36(10,11)31(4,5)6/h14-16,22-23,27-30H,2-3,17-21,24-25H2,1,4-13H3/b16-14+/t27-,28-,29-,30+,33-/m1/s1 |
| InChIKey | SFRHIRRJDBOKGV-DNFDFLGGSA-N |
| XLogP | 10.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|