C20H36O6Si — CID 24756330
(E,5R)-5-[(E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoyl]oxyhex-2-enoic acid (PubChem CID 24756330) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is (E,5R)-5-[(E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoyl]oxyhex-2-enoic acid.
| Compound Name | (E,5R)-5-[(E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoyl]oxyhex-2-enoic acid |
|---|---|
| PubChem CID | 24756330 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (E,5R)-5-[(E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoyl]oxyhex-2-enoic acid |
| SMILES | C[C@H](C/C=C/C(=O)O)OC(=O)/C=C/C[C@@H](C[C@@H](C)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O6Si/c1-15(21)14-17(26-27(6,7)20(3,4)5)11-9-13-19(24)25-16(2)10-8-12-18(22)23/h8-9,12-13,15-17,21H,10-11,14H2,1-7H3,(H,22,23)/b12-8+,13-9+/t15-,16-,17+/m1/s1 |
| InChIKey | WVXLDYDTNSHXHQ-DLNXUBGTSA-N |
| XLogP | 4.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|