C20H19F3N2O5 — CID 24756593
methyl (2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]phenyl]acetate (PubChem CID 24756593) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 24756593 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethoxy)phenyl]ethylideneamino]oxymethyl]phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1CO/N=C(\C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O5/c1-13(14-8-6-9-16(11-14)30-20(21,22)23)24-29-12-15-7-4-5-10-17(15)18(25-28-3)19(26)27-2/h4-11H,12H2,1-3H3/b24-13+,25-18+ |
| InChIKey | VAERKQUVZUCZKT-TVJDWZFNSA-N |
| XLogP | 4.05 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|