C17H14IN3S — CID 24756735
4-(6-(123I)iodoimidazo[2,1-b][1,3]benzothiazol-2-yl)-N,N-dimethyl(123I)aniline (PubChem CID 24756735) has the molecular formula C17H14IN3S and a molecular weight of 415.29 g/mol. Its IUPAC name is 4-(6-(123I)iodoimidazo[2,1-b][1,3]benzothiazol-2-yl)-N,N-dimethyl(123I)aniline.
| Compound Name | 4-(6-(123I)iodoimidazo[2,1-b][1,3]benzothiazol-2-yl)-N,N-dimethyl(123I)aniline |
|---|---|
| PubChem CID | 24756735 |
| Molecular Formula | C17H14IN3S |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 4-(6-(123I)iodoimidazo[2,1-b][1,3]benzothiazol-2-yl)-N,N-dimethyl(123I)aniline |
| SMILES | CN(C)c1ccc(-c2cn3c(n2)sc2cc([123I])ccc23)cc1 |
| InChI | InChI=1S/C17H14IN3S/c1-20(2)13-6-3-11(4-7-13)14-10-21-15-8-5-12(18)9-16(15)22-17(21)19-14/h3-10H,1-2H3/i18-4 |
| InChIKey | QRMAMSGFRUQLON-GSLGWBAQSA-N |
| XLogP | 4.89 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|