C10H14O — CID 24756745
[(3aS,7aS)-2,3,3a,7a-tetrahydro-1H-inden-4-yl]methanol (PubChem CID 24756745) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,3a,7a-tetrahydro-1H-inden-4-yl]methanol.
| Compound Name | [(3aS,7aS)-2,3,3a,7a-tetrahydro-1H-inden-4-yl]methanol |
|---|---|
| PubChem CID | 24756745 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | [(3aS,7aS)-2,3,3a,7a-tetrahydro-1H-inden-4-yl]methanol |
| SMILES | OCC1=CC=C[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C10H14O/c11-7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5,8,10-11H,2,4,6-7H2/t8-,10+/m1/s1 |
| InChIKey | ZNALYRSQJJGLPK-SCZZXKLOSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |