C21H23FN4O4 — CID 24756751
(2E)-2-[2-[[(E)-[(1E)-1-(4-fluorophenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 24756751) has the molecular formula C21H23FN4O4 and a molecular weight of 414.44 g/mol. Its IUPAC name is (2E)-2-[2-[[(E)-[(1E)-1-(4-fluorophenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[[(E)-[(1E)-1-(4-fluorophenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 24756751 |
| Molecular Formula | C21H23FN4O4 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (2E)-2-[2-[[(E)-[(1E)-1-(4-fluorophenyl)-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1CO/N=C(C)/C(=N/OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN4O4/c1-14(19(25-28-3)15-9-11-17(22)12-10-15)24-30-13-16-7-5-6-8-18(16)20(26-29-4)21(27)23-2/h5-12H,13H2,1-4H3,(H,23,27)/b24-14+,25-19-,26-20+ |
| InChIKey | YDGQLIGPIHTEDA-WLNFNKBRSA-N |
| XLogP | 2.87 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|