C17H13BrN2O2S2 — CID 24757030
(5Z)-5-[[5-bromo-2-(2-pyridin-2-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 24757030) has the molecular formula C17H13BrN2O2S2 and a molecular weight of 421.34 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-(2-pyridin-2-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-2-(2-pyridin-2-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24757030 |
| Molecular Formula | C17H13BrN2O2S2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-(2-pyridin-2-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc(Br)ccc1OCCc1ccccn1 |
| InChI | InChI=1S/C17H13BrN2O2S2/c18-12-4-5-14(22-8-6-13-3-1-2-7-19-13)11(9-12)10-15-16(21)20-17(23)24-15/h1-5,7,9-10H,6,8H2,(H,20,21,23)/b15-10- |
| InChIKey | NEOLYMJLBFHZNA-GDNBJRDFSA-N |
| XLogP | 3.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|