C6H13NO — CID 24757927
(2R,5R)-2,4,5-trimethyl-1,3-oxazolidine (PubChem CID 24757927) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is (2R,5R)-2,4,5-trimethyl-1,3-oxazolidine.
| Compound Name | (2R,5R)-2,4,5-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 24757927 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (2R,5R)-2,4,5-trimethyl-1,3-oxazolidine |
| SMILES | CC1N[C@@H](C)O[C@@H]1C |
| InChI | InChI=1S/C6H13NO/c1-4-5(2)8-6(3)7-4/h4-7H,1-3H3/t4?,5-,6-/m1/s1 |
| InChIKey | KGOJHIRKYWXNFA-YSLANXFLSA-N |
| XLogP | 0.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |