C25H20F5N3O3S — CID 24758121
N-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide (PubChem CID 24758121) has the molecular formula C25H20F5N3O3S and a molecular weight of 537.51 g/mol. Its IUPAC name is N-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 24758121 |
| Molecular Formula | C25H20F5N3O3S |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | N-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1ccc2nc(/C=C/c3ccc(OCC(F)(F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H20F5N3O3S/c1-37(34,35)33-20-5-3-2-4-19(20)17-9-12-21-22(14-17)32-23(31-21)13-8-16-6-10-18(11-7-16)36-15-24(26,27)25(28,29)30/h2-14,33H,15H2,1H3,(H,31,32)/b13-8+ |
| InChIKey | XVFCGAOAQYWTAG-MDWZMJQESA-N |
| XLogP | 6.35 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|