C27H23F5N2O2 — CID 24758122
2-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol (PubChem CID 24758122) has the molecular formula C27H23F5N2O2 and a molecular weight of 502.48 g/mol. Its IUPAC name is 2-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol.
| Compound Name | 2-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 24758122 |
| Molecular Formula | C27H23F5N2O2 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-[2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccccc1-c1ccc2nc(/C=C/c3ccc(OCC(F)(F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H23F5N2O2/c1-25(2,35)21-6-4-3-5-20(21)18-10-13-22-23(15-18)34-24(33-22)14-9-17-7-11-19(12-8-17)36-16-26(28,29)27(30,31)32/h3-15,35H,16H2,1-2H3,(H,33,34)/b14-9+ |
| InChIKey | VRPIENCRGASDQK-NTEUORMPSA-N |
| XLogP | 7.20 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|