C24H18F5N3O3S — CID 24758123
2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 24758123) has the molecular formula C24H18F5N3O3S and a molecular weight of 523.48 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24758123 |
| Molecular Formula | C24H18F5N3O3S |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 2-[2-[(E)-2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2nc(/C=C/c3ccc(OCC(F)(F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H18F5N3O3S/c25-23(26,24(27,28)29)14-35-17-9-5-15(6-10-17)7-12-22-31-19-11-8-16(13-20(19)32-22)18-3-1-2-4-21(18)36(30,33)34/h1-13H,14H2,(H,31,32)(H2,30,33,34)/b12-7+ |
| InChIKey | GFUWXLYNKIHDDI-KPKJPENVSA-N |
| XLogP | 5.62 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|