About 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate
1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate (PubChem CID 24758463) has the molecular formula C17H20F6N2O4
and a molecular weight of 430.35 g/mol. Its IUPAC name is 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate.
Molecular Properties
| Compound Name | 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate |
| PubChem CID | 24758463 |
| Molecular Formula | C17H20F6N2O4 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)COC(=O)NCC(C)OC(=O)Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F6N2O4/c1-9(2)8-28-14(26)24-7-10(3)29-15(27)25-11-4-5-12(16(18,19)20)13(6-11)17(21,22)23/h4-6,9-10H,7-8H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | WVYYYXWXXBTASQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate?
The IUPAC name of 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate (CID 24758463) is 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate.
What is the SMILES notation for 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate?
The canonical SMILES for 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate is CC(C)COC(=O)NCC(C)OC(=O)Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1.
What is the InChIKey of 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate?
The InChIKey is WVYYYXWXXBTASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F6N2O4/c1-9(2)8-28-14(26)24-7-10(3)29-15(27)25-11-4-5-12(16(18,19)20)13(6-11)17(21,22)23/h4-6,9-10H,7-8H2,1-3H3,(H,24,26)(H,25,27).
What are the key properties of 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate?
1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate has a molecular weight of 430.35 g/mol, XLogP of 5.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropoxycarbonylamino)propan-2-yl N-[3,4-bis(trifluoromethyl)phenyl]carbamate is sourced from PubChem (CID 24758463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).