C23H28ClN5S2 — CID 24758481
5-[5-[3-(6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole (PubChem CID 24758481) has the molecular formula C23H28ClN5S2 and a molecular weight of 474.10 g/mol. Its IUPAC name is 5-[5-[3-(6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole.
| Compound Name | 5-[5-[3-(6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 24758481 |
| Molecular Formula | C23H28ClN5S2 |
| Molecular Weight | 474.10 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 5-[5-[3-(6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-1'-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SCCCN3CCC4(CCc5cc(Cl)ccc54)C3)n2C)s1 |
| InChI | InChI=1S/C23H28ClN5S2/c1-15-20(31-16(2)25-15)21-26-27-22(28(21)3)30-12-4-10-29-11-9-23(14-29)8-7-17-13-18(24)5-6-19(17)23/h5-6,13H,4,7-12,14H2,1-3H3 |
| InChIKey | YANOQHGMWHDKKI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.10 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|