C19H20F2N2O2 — CID 24758659
6-(3,4-difluoroanilino)-4,4-diethyl-1-methyl-3,1-benzoxazin-2-one (PubChem CID 24758659) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 6-(3,4-difluoroanilino)-4,4-diethyl-1-methyl-3,1-benzoxazin-2-one.
| Compound Name | 6-(3,4-difluoroanilino)-4,4-diethyl-1-methyl-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 24758659 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6-(3,4-difluoroanilino)-4,4-diethyl-1-methyl-3,1-benzoxazin-2-one |
| SMILES | CCC1(CC)OC(=O)N(C)c2ccc(Nc3ccc(F)c(F)c3)cc21 |
| InChI | InChI=1S/C19H20F2N2O2/c1-4-19(5-2)14-10-12(7-9-17(14)23(3)18(24)25-19)22-13-6-8-15(20)16(21)11-13/h6-11,22H,4-5H2,1-3H3 |
| InChIKey | CNJCRJFXKFCKJI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |