About methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate
methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate (PubChem CID 24758671) has the molecular formula C20H16Cl2N4O2
and a molecular weight of 415.28 g/mol. Its IUPAC name is methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate |
| PubChem CID | 24758671 |
| Molecular Formula | C20H16Cl2N4O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1cncn1Cc1c2cccc(-c3ccc(Cl)cc3Cl)c2nn1C |
| InChI | InChI=1S/C20H16Cl2N4O2/c1-25-18(10-26-11-23-9-17(26)20(27)28-2)15-5-3-4-14(19(15)24-25)13-7-6-12(21)8-16(13)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | WXZZDOCBJLRFIN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate?
The IUPAC name of methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate (CID 24758671) is methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate.
What is the SMILES notation for methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate?
The canonical SMILES for methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate is COC(=O)c1cncn1Cc1c2cccc(-c3ccc(Cl)cc3Cl)c2nn1C.
What is the InChIKey of methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate?
The InChIKey is WXZZDOCBJLRFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl2N4O2/c1-25-18(10-26-11-23-9-17(26)20(27)28-2)15-5-3-4-14(19(15)24-25)13-7-6-12(21)8-16(13)22/h3-9,11H,10H2,1-2H3.
What are the key properties of methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate?
methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate has a molecular weight of 415.28 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]methyl]imidazole-4-carboxylate is sourced from PubChem (CID 24758671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).