C27H30N4S — CID 24758686
N'-[2-benzyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide (PubChem CID 24758686) has the molecular formula C27H30N4S and a molecular weight of 442.63 g/mol. Its IUPAC name is N'-[2-benzyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[2-benzyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 24758686 |
| Molecular Formula | C27H30N4S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N'-[2-benzyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-5-yl]thiophene-2-carboximidamide |
| SMILES | CN1CCCC1CCn1c(Cc2ccccc2)cc2cc(/N=C(\N)c3cccs3)ccc21 |
| InChI | InChI=1S/C27H30N4S/c1-30-14-5-9-23(30)13-15-31-24(17-20-7-3-2-4-8-20)19-21-18-22(11-12-25(21)31)29-27(28)26-10-6-16-32-26/h2-4,6-8,10-12,16,18-19,23H,5,9,13-15,17H2,1H3,(H2,28,29) |
| InChIKey | XTMKEUKOMOGBTF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|