C27H22F6N2O2 — CID 24759692
2-[2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol (PubChem CID 24759692) has the molecular formula C27H22F6N2O2 and a molecular weight of 520.47 g/mol. Its IUPAC name is 2-[2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol.
| Compound Name | 2-[2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 24759692 |
| Molecular Formula | C27H22F6N2O2 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccccc1-c1ccc2nc(/C=C/c3ccc(OC(C(F)(F)F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H22F6N2O2/c1-25(2,36)20-6-4-3-5-19(20)17-10-13-21-22(15-17)35-23(34-21)14-9-16-7-11-18(12-8-16)37-24(26(28,29)30)27(31,32)33/h3-15,24,36H,1-2H3,(H,34,35)/b14-9+ |
| InChIKey | BNPHCKRUBAMHSZ-NTEUORMPSA-N |
| XLogP | 7.50 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |