C24H17F6N3O3S — CID 24759693
2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 24759693) has the molecular formula C24H17F6N3O3S and a molecular weight of 541.47 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24759693 |
| Molecular Formula | C24H17F6N3O3S |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 2-[2-[(E)-2-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2nc(/C=C/c3ccc(OC(C(F)(F)F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H17F6N3O3S/c25-23(26,27)22(24(28,29)30)36-16-9-5-14(6-10-16)7-12-21-32-18-11-8-15(13-19(18)33-21)17-3-1-2-4-20(17)37(31,34)35/h1-13,22H,(H,32,33)(H2,31,34,35)/b12-7+ |
| InChIKey | UHYBEKPLECXFKX-KPKJPENVSA-N |
| XLogP | 5.92 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |