C24H25F2NO5 — CID 24759837
(2R,3R,4S,5S,6R)-2-[3-[(4-cyclopropylphenyl)methyl]-4,6-difluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 24759837) has the molecular formula C24H25F2NO5 and a molecular weight of 445.46 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-[(4-cyclopropylphenyl)methyl]-4,6-difluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-[(4-cyclopropylphenyl)methyl]-4,6-difluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 24759837 |
| Molecular Formula | C24H25F2NO5 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-[(4-cyclopropylphenyl)methyl]-4,6-difluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(F)cc(F)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H25F2NO5/c25-16-8-17(26)20-15(7-12-1-3-13(4-2-12)14-5-6-14)10-27(18(20)9-16)24-23(31)22(30)21(29)19(11-28)32-24/h1-4,8-10,14,19,21-24,28-31H,5-7,11H2/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | UTFVDMCHZXTLTA-PFKOEMKTSA-N |
| XLogP | 2.36 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |