About N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide
N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide (PubChem CID 24760043) has the molecular formula C11H10BrF3N4
and a molecular weight of 335.13 g/mol. Its IUPAC name is N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide.
Molecular Properties
| Compound Name | N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide |
| PubChem CID | 24760043 |
| Molecular Formula | C11H10BrF3N4 |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide |
| SMILES | C/C(=N\C#N)N(Cc1cnc(Br)c(F)c1)CC(F)F |
| InChI | InChI=1S/C11H10BrF3N4/c1-7(18-6-16)19(5-10(14)15)4-8-2-9(13)11(12)17-3-8/h2-3,10H,4-5H2,1H3/b18-7+ |
| InChIKey | QHQAKEDGVNUEPG-CNHKJKLMSA-N |
| XLogP | 2.95 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
The IUPAC name of N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide (CID 24760043) is N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide.
What is the SMILES notation for N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
The canonical SMILES for N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide is C/C(=N\C#N)N(Cc1cnc(Br)c(F)c1)CC(F)F.
What is the InChIKey of N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
The InChIKey is QHQAKEDGVNUEPG-CNHKJKLMSA-N. The full InChI is InChI=1S/C11H10BrF3N4/c1-7(18-6-16)19(5-10(14)15)4-8-2-9(13)11(12)17-3-8/h2-3,10H,4-5H2,1H3/b18-7+.
What are the key properties of N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide has a molecular weight of 335.13 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromo-5-fluoro-3-pyridinyl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide is sourced from PubChem (CID 24760043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).