About N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide (PubChem CID 24760046) has the molecular formula C9H9ClF2N4S
and a molecular weight of 278.72 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide.
Molecular Properties
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide |
| PubChem CID | 24760046 |
| Molecular Formula | C9H9ClF2N4S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide |
| SMILES | C/C(=N\C#N)N(Cc1cnc(Cl)s1)CC(F)F |
| InChI | InChI=1S/C9H9ClF2N4S/c1-6(15-5-13)16(4-8(11)12)3-7-2-14-9(10)17-7/h2,8H,3-4H2,1H3/b15-6+ |
| InChIKey | GNDSGVGMRUATQS-GIDUJCDVSA-N |
| XLogP | 2.76 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
The IUPAC name of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide (CID 24760046) is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide.
What is the SMILES notation for N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
The canonical SMILES for N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide is C/C(=N\C#N)N(Cc1cnc(Cl)s1)CC(F)F.
What is the InChIKey of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
The InChIKey is GNDSGVGMRUATQS-GIDUJCDVSA-N. The full InChI is InChI=1S/C9H9ClF2N4S/c1-6(15-5-13)16(4-8(11)12)3-7-2-14-9(10)17-7/h2,8H,3-4H2,1H3/b15-6+.
What are the key properties of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide?
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide has a molecular weight of 278.72 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N'-cyano-N-(2,2-difluoroethyl)ethanimidamide is sourced from PubChem (CID 24760046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).