About 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid
2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid (PubChem CID 2476033) has the molecular formula C11H8N4O2S
and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid.
Analyze 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid?
The IUPAC name of 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid (CID 2476033) is 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid.
What is the SMILES notation for 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid?
The canonical SMILES for 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid is O=C(O)CSc1nnc2c3ccccc3ncn12.
What is the InChIKey of 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid?
The InChIKey is WDVZOCQKPIZDDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2S/c16-9(17)5-18-11-14-13-10-7-3-1-2-4-8(7)12-6-15(10)11/h1-4,6H,5H2,(H,16,17).
What are the key properties of 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid?
2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid has a molecular weight of 260.28 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[4,3-c]quinazolin-3-ylsulfanyl)acetic acid is sourced from PubChem (CID 2476033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).