C22H29N3O4 — CID 24760701
N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]isoquinoline-1-carboxamide (PubChem CID 24760701) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]isoquinoline-1-carboxamide.
| Compound Name | N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 24760701 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[(3S,5R)-5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]isoquinoline-1-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)c1nccc2ccccc12)C(C)C |
| InChI | InChI=1S/C22H29N3O4/c1-4-5-8-17(13-25(29)14-26)21(27)19(15(2)3)24-22(28)20-18-10-7-6-9-16(18)11-12-23-20/h6-7,9-12,14-15,17,19,29H,4-5,8,13H2,1-3H3,(H,24,28)/t17-,19+/m1/s1 |
| InChIKey | PCZBLJVAXPRBJR-MJGOQNOKSA-N |
| XLogP | 3.21 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|