C14H10Br2O5 — CID 24761045
4,11-dibromo-5,7-dihydrobenzo[d][2]benzoxepine-2,3,9,10-tetrol (PubChem CID 24761045) has the molecular formula C14H10Br2O5 and a molecular weight of 418.04 g/mol. Its IUPAC name is 4,11-dibromo-5,7-dihydrobenzo[d][2]benzoxepine-2,3,9,10-tetrol.
| Compound Name | 4,11-dibromo-5,7-dihydrobenzo[d][2]benzoxepine-2,3,9,10-tetrol |
|---|---|
| PubChem CID | 24761045 |
| Molecular Formula | C14H10Br2O5 |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 415.89 |
| IUPAC Name | 4,11-dibromo-5,7-dihydrobenzo[d][2]benzoxepine-2,3,9,10-tetrol |
| SMILES | Oc1cc2c(c(Br)c1O)COCc1cc(O)c(O)c(Br)c1-2 |
| InChI | InChI=1S/C14H10Br2O5/c15-11-7-4-21-3-5-1-8(17)14(20)12(16)10(5)6(7)2-9(18)13(11)19/h1-2,17-20H,3-4H2 |
| InChIKey | ZRGSUBOWCSFYON-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|