About N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid
N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid (PubChem CID 24761105) has the molecular formula C16H21F2N3O5
and a molecular weight of 373.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid |
| PubChem CID | 24761105 |
| Molecular Formula | C16H21F2N3O5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid |
| SMILES | CC(C(=O)Nc1ccc(F)c(F)c1)N1CCN(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19F2N3O.C2H2O4/c1-10(19-7-5-18(2)6-8-19)14(20)17-11-3-4-12(15)13(16)9-11;3-1(4)2(5)6/h3-4,9-10H,5-8H2,1-2H3,(H,17,20);(H,3,4)(H,5,6) |
| InChIKey | PLXPSWPCNGAHRX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid?
The IUPAC name of N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid (CID 24761105) is N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid.
What is the SMILES notation for N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid?
The canonical SMILES for N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid is CC(C(=O)Nc1ccc(F)c(F)c1)N1CCN(C)CC1.O=C(O)C(=O)O.
What is the InChIKey of N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid?
The InChIKey is PLXPSWPCNGAHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2N3O.C2H2O4/c1-10(19-7-5-18(2)6-8-19)14(20)17-11-3-4-12(15)13(16)9-11;3-1(4)2(5)6/h3-4,9-10H,5-8H2,1-2H3,(H,17,20);(H,3,4)(H,5,6).
What are the key properties of N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid?
N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid has a molecular weight of 373.36 g/mol, XLogP of 0.69, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-2-(4-methylpiperazin-1-yl)propanamide;oxalic acid is sourced from PubChem (CID 24761105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).