C22H27N3O8 — CID 24761106
oxalic acid;[4-(pyridin-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 24761106) has the molecular formula C22H27N3O8 and a molecular weight of 461.47 g/mol. Its IUPAC name is oxalic acid;[4-(pyridin-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | oxalic acid;[4-(pyridin-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 24761106 |
| Molecular Formula | C22H27N3O8 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | oxalic acid;[4-(pyridin-2-ylmethyl)piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCN(Cc3ccccn3)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H25N3O4.C2H2O4/c1-25-17-12-15(13-18(26-2)19(17)27-3)20(24)23-10-8-22(9-11-23)14-16-6-4-5-7-21-16;3-1(4)2(5)6/h4-7,12-13H,8-11,14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ROCQKUINMYAXAR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|