C16H16ClN3O4 — CID 24761124
6-methoxy-1-(5-nitrofuran-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 24761124) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is 6-methoxy-1-(5-nitrofuran-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 6-methoxy-1-(5-nitrofuran-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 24761124 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 6-methoxy-1-(5-nitrofuran-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3c1ccc([N+](=O)[O-])o1.Cl |
| InChI | InChI=1S/C16H15N3O4.ClH/c1-22-9-2-3-12-11(8-9)10-6-7-17-16(15(10)18-12)13-4-5-14(23-13)19(20)21;/h2-5,8,16-18H,6-7H2,1H3;1H |
| InChIKey | FCZJCOKJUMNOES-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|