About (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride
(3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride (PubChem CID 24761164) has the molecular formula C17H26ClNO2
and a molecular weight of 311.85 g/mol. Its IUPAC name is (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride.
Molecular Properties
| Compound Name | (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride |
| PubChem CID | 24761164 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride |
| SMILES | CC(C)(C)C(CN1CCCC1)OC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C17H25NO2.ClH/c1-17(2,3)15(13-18-11-7-8-12-18)20-16(19)14-9-5-4-6-10-14;/h4-6,9-10,15H,7-8,11-13H2,1-3H3;1H |
| InChIKey | UTVCLZKTURRCHN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride?
The IUPAC name of (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride (CID 24761164) is (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride.
What is the SMILES notation for (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride?
The canonical SMILES for (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride is CC(C)(C)C(CN1CCCC1)OC(=O)c1ccccc1.Cl.
What is the InChIKey of (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride?
The InChIKey is UTVCLZKTURRCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2.ClH/c1-17(2,3)15(13-18-11-7-8-12-18)20-16(19)14-9-5-4-6-10-14;/h4-6,9-10,15H,7-8,11-13H2,1-3H3;1H.
What are the key properties of (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride?
(3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride has a molecular weight of 311.85 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-yl) benzoate;hydrochloride is sourced from PubChem (CID 24761164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).