About 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride
2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride (PubChem CID 24761181) has the molecular formula C19H31ClN2O
and a molecular weight of 338.92 g/mol. Its IUPAC name is 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride |
| PubChem CID | 24761181 |
| Molecular Formula | C19H31ClN2O |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride |
| SMILES | Cc1ccc(CN2CCC(N3CC(C)OC(C)C3)CC2)cc1.Cl |
| InChI | InChI=1S/C19H30N2O.ClH/c1-15-4-6-18(7-5-15)14-20-10-8-19(9-11-20)21-12-16(2)22-17(3)13-21;/h4-7,16-17,19H,8-14H2,1-3H3;1H |
| InChIKey | OZLGARSHPRXXOX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride?
The IUPAC name of 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride (CID 24761181) is 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride.
What is the SMILES notation for 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride?
The canonical SMILES for 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride is Cc1ccc(CN2CCC(N3CC(C)OC(C)C3)CC2)cc1.Cl.
What is the InChIKey of 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride?
The InChIKey is OZLGARSHPRXXOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O.ClH/c1-15-4-6-18(7-5-15)14-20-10-8-19(9-11-20)21-12-16(2)22-17(3)13-21;/h4-7,16-17,19H,8-14H2,1-3H3;1H.
What are the key properties of 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride?
2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride has a molecular weight of 338.92 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]morpholine;hydrochloride is sourced from PubChem (CID 24761181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).